C10H10N4O2S — CID 23461605
N-[2-(2-cyanoaziridin-1-yl)-2-oxoethyl]-2-methyl-1,3-thiazole-5-carboxamide (PubChem CID 23461605) has the molecular formula C10H10N4O2S and a molecular weight of 250.28 g/mol. Its IUPAC name is N-[2-(2-cyanoaziridin-1-yl)-2-oxoethyl]-2-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[2-(2-cyanoaziridin-1-yl)-2-oxoethyl]-2-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 23461605 |
| Molecular Formula | C10H10N4O2S |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | N-[2-(2-cyanoaziridin-1-yl)-2-oxoethyl]-2-methyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1ncc(C(=O)NCC(=O)N2CC2C#N)s1 |
| InChI | InChI=1S/C10H10N4O2S/c1-6-12-3-8(17-6)10(16)13-4-9(15)14-5-7(14)2-11/h3,7H,4-5H2,1H3,(H,13,16) |
| InChIKey | KUCRZMCYSMLKPS-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 85.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|