C23H28O4 — CID 23466040
ethyl (E)-3-hydroxy-3-methyl-7-(4-phenylmethoxyphenyl)hept-4-enoate (PubChem CID 23466040) has the molecular formula C23H28O4 and a molecular weight of 368.47 g/mol. Its IUPAC name is ethyl (E)-3-hydroxy-3-methyl-7-(4-phenylmethoxyphenyl)hept-4-enoate.
| Compound Name | ethyl (E)-3-hydroxy-3-methyl-7-(4-phenylmethoxyphenyl)hept-4-enoate |
|---|---|
| PubChem CID | 23466040 |
| Molecular Formula | C23H28O4 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | ethyl (E)-3-hydroxy-3-methyl-7-(4-phenylmethoxyphenyl)hept-4-enoate |
| SMILES | CCOC(=O)CC(C)(O)/C=C/CCc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H28O4/c1-3-26-22(24)17-23(2,25)16-8-7-9-19-12-14-21(15-13-19)27-18-20-10-5-4-6-11-20/h4-6,8,10-16,25H,3,7,9,17-18H2,1-2H3/b16-8+ |
| InChIKey | OIRPMTJVPRBOPN-LZYBPNLTSA-N |
| XLogP | 4.46 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|