C14H20O4 — CID 23469413
3-(6-oxabicyclo[3.1.1]heptan-3-ylmethyl)-7-oxabicyclo[4.1.0]heptane-3-carboxylic acid (PubChem CID 23469413) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is 3-(6-oxabicyclo[3.1.1]heptan-3-ylmethyl)-7-oxabicyclo[4.1.0]heptane-3-carboxylic acid.
| Compound Name | 3-(6-oxabicyclo[3.1.1]heptan-3-ylmethyl)-7-oxabicyclo[4.1.0]heptane-3-carboxylic acid |
|---|---|
| PubChem CID | 23469413 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 3-(6-oxabicyclo[3.1.1]heptan-3-ylmethyl)-7-oxabicyclo[4.1.0]heptane-3-carboxylic acid |
| SMILES | O=C(O)C1(CC2CC3CC(C2)O3)CCC2OC2C1 |
| InChI | InChI=1S/C14H20O4/c15-13(16)14(2-1-11-12(7-14)18-11)6-8-3-9-5-10(4-8)17-9/h8-12H,1-7H2,(H,15,16) |
| InChIKey | NCRKOLJBRRPOHV-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|