C25H27N3O5 — CID 23472837
2-[2-(diethylamino)ethyl]-7-ethyl-1-(4-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 23472837) has the molecular formula C25H27N3O5 and a molecular weight of 449.51 g/mol. Its IUPAC name is 2-[2-(diethylamino)ethyl]-7-ethyl-1-(4-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 2-[2-(diethylamino)ethyl]-7-ethyl-1-(4-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 23472837 |
| Molecular Formula | C25H27N3O5 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 2-[2-(diethylamino)ethyl]-7-ethyl-1-(4-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCc1ccc2oc3c(c(=O)c2c1)C(c1ccc([N+](=O)[O-])cc1)N(CCN(CC)CC)C3=O |
| InChI | InChI=1S/C25H27N3O5/c1-4-16-7-12-20-19(15-16)23(29)21-22(17-8-10-18(11-9-17)28(31)32)27(25(30)24(21)33-20)14-13-26(5-2)6-3/h7-12,15,22H,4-6,13-14H2,1-3H3 |
| InChIKey | FCVIJZOFGZOKCZ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 96.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|