C27H33N3O3S2 — CID 23473734
ethyl 1-[6-methyl-3-[(Z)-(4-oxo-3-pentyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]quinolin-2-yl]piperidine-4-carboxylate (PubChem CID 23473734) has the molecular formula C27H33N3O3S2 and a molecular weight of 511.71 g/mol. Its IUPAC name is ethyl 1-[6-methyl-3-[(Z)-(4-oxo-3-pentyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]quinolin-2-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[6-methyl-3-[(Z)-(4-oxo-3-pentyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]quinolin-2-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 23473734 |
| Molecular Formula | C27H33N3O3S2 |
| Molecular Weight | 511.71 g/mol |
| Exact Mass | 511.20 |
| IUPAC Name | ethyl 1-[6-methyl-3-[(Z)-(4-oxo-3-pentyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]quinolin-2-yl]piperidine-4-carboxylate |
| SMILES | CCCCCN1C(=O)/C(=C/c2cc3cc(C)ccc3nc2N2CCC(C(=O)OCC)CC2)SC1=S |
| InChI | InChI=1S/C27H33N3O3S2/c1-4-6-7-12-30-25(31)23(35-27(30)34)17-21-16-20-15-18(3)8-9-22(20)28-24(21)29-13-10-19(11-14-29)26(32)33-5-2/h8-9,15-17,19H,4-7,10-14H2,1-3H3/b23-17- |
| InChIKey | NZAZHGGJAWYBRH-QJOMJCCJSA-N |
| XLogP | 5.71 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.71 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|