C34H33N3OS2 — CID 23473800
(5Z)-5-[[2-(4-benzylpiperidin-1-yl)-6-methylquinolin-3-yl]methylidene]-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 23473800) has the molecular formula C34H33N3OS2 and a molecular weight of 563.79 g/mol. Its IUPAC name is (5Z)-5-[[2-(4-benzylpiperidin-1-yl)-6-methylquinolin-3-yl]methylidene]-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[2-(4-benzylpiperidin-1-yl)-6-methylquinolin-3-yl]methylidene]-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 23473800 |
| Molecular Formula | C34H33N3OS2 |
| Molecular Weight | 563.79 g/mol |
| Exact Mass | 563.21 |
| IUPAC Name | (5Z)-5-[[2-(4-benzylpiperidin-1-yl)-6-methylquinolin-3-yl]methylidene]-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc2nc(N3CCC(Cc4ccccc4)CC3)c(/C=C3\SC(=S)N(CCc4ccccc4)C3=O)cc2c1 |
| InChI | InChI=1S/C34H33N3OS2/c1-24-12-13-30-28(20-24)22-29(23-31-33(38)37(34(39)40-31)19-16-25-8-4-2-5-9-25)32(35-30)36-17-14-27(15-18-36)21-26-10-6-3-7-11-26/h2-13,20,22-23,27H,14-19,21H2,1H3/b31-23- |
| InChIKey | RDTXLKVNCWIWIZ-SXBRIOAWSA-N |
| XLogP | 7.45 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.79 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|