C30H33N3O2S2 — CID 23473760
(5Z)-5-[[2-(4-benzylpiperidin-1-yl)quinolin-3-yl]methylidene]-3-(3-ethoxypropyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 23473760) has the molecular formula C30H33N3O2S2 and a molecular weight of 531.75 g/mol. Its IUPAC name is (5Z)-5-[[2-(4-benzylpiperidin-1-yl)quinolin-3-yl]methylidene]-3-(3-ethoxypropyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[2-(4-benzylpiperidin-1-yl)quinolin-3-yl]methylidene]-3-(3-ethoxypropyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 23473760 |
| Molecular Formula | C30H33N3O2S2 |
| Molecular Weight | 531.75 g/mol |
| Exact Mass | 531.20 |
| IUPAC Name | (5Z)-5-[[2-(4-benzylpiperidin-1-yl)quinolin-3-yl]methylidene]-3-(3-ethoxypropyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCOCCCN1C(=O)/C(=C/c2cc3ccccc3nc2N2CCC(Cc3ccccc3)CC2)SC1=S |
| InChI | InChI=1S/C30H33N3O2S2/c1-2-35-18-8-15-33-29(34)27(37-30(33)36)21-25-20-24-11-6-7-12-26(24)31-28(25)32-16-13-23(14-17-32)19-22-9-4-3-5-10-22/h3-7,9-12,20-21,23H,2,8,13-19H2,1H3/b27-21- |
| InChIKey | ABARTFWUQOIMEY-MEFGMAGPSA-N |
| XLogP | 6.32 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.75 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|