C27H27N3OS2 — CID 23473520
(5Z)-5-[(8-methyl-2-piperidin-1-ylquinolin-3-yl)methylidene]-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 23473520) has the molecular formula C27H27N3OS2 and a molecular weight of 473.67 g/mol. Its IUPAC name is (5Z)-5-[(8-methyl-2-piperidin-1-ylquinolin-3-yl)methylidene]-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(8-methyl-2-piperidin-1-ylquinolin-3-yl)methylidene]-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 23473520 |
| Molecular Formula | C27H27N3OS2 |
| Molecular Weight | 473.67 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | (5Z)-5-[(8-methyl-2-piperidin-1-ylquinolin-3-yl)methylidene]-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Cc1cccc2cc(/C=C3\SC(=S)N(CCc4ccccc4)C3=O)c(N3CCCCC3)nc12 |
| InChI | InChI=1S/C27H27N3OS2/c1-19-9-8-12-21-17-22(25(28-24(19)21)29-14-6-3-7-15-29)18-23-26(31)30(27(32)33-23)16-13-20-10-4-2-5-11-20/h2,4-5,8-12,17-18H,3,6-7,13-16H2,1H3/b23-18- |
| InChIKey | LCAGOCVXPGTSLR-NKFKGCMQSA-N |
| XLogP | 5.98 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.67 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|