C24H28N4O2S2 — CID 23473833
1-[8-methyl-3-[(Z)-[3-(2-methylpropyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]quinolin-2-yl]piperidine-4-carboxamide (PubChem CID 23473833) has the molecular formula C24H28N4O2S2 and a molecular weight of 468.65 g/mol. Its IUPAC name is 1-[8-methyl-3-[(Z)-[3-(2-methylpropyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]quinolin-2-yl]piperidine-4-carboxamide.
| Compound Name | 1-[8-methyl-3-[(Z)-[3-(2-methylpropyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]quinolin-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 23473833 |
| Molecular Formula | C24H28N4O2S2 |
| Molecular Weight | 468.65 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | 1-[8-methyl-3-[(Z)-[3-(2-methylpropyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]quinolin-2-yl]piperidine-4-carboxamide |
| SMILES | Cc1cccc2cc(/C=C3\SC(=S)N(CC(C)C)C3=O)c(N3CCC(C(N)=O)CC3)nc12 |
| InChI | InChI=1S/C24H28N4O2S2/c1-14(2)13-28-23(30)19(32-24(28)31)12-18-11-17-6-4-5-15(3)20(17)26-22(18)27-9-7-16(8-10-27)21(25)29/h4-6,11-12,14,16H,7-10,13H2,1-3H3,(H2,25,29)/b19-12- |
| InChIKey | FYXVJLCPASZLBG-UNOMPAQXSA-N |
| XLogP | 4.10 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.65 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|