C25H28N4O2S2 — CID 23473838
1-[3-[(Z)-(3-cyclopentyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-8-methylquinolin-2-yl]piperidine-4-carboxamide (PubChem CID 23473838) has the molecular formula C25H28N4O2S2 and a molecular weight of 480.66 g/mol. Its IUPAC name is 1-[3-[(Z)-(3-cyclopentyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-8-methylquinolin-2-yl]piperidine-4-carboxamide.
| Compound Name | 1-[3-[(Z)-(3-cyclopentyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-8-methylquinolin-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 23473838 |
| Molecular Formula | C25H28N4O2S2 |
| Molecular Weight | 480.66 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | 1-[3-[(Z)-(3-cyclopentyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-8-methylquinolin-2-yl]piperidine-4-carboxamide |
| SMILES | Cc1cccc2cc(/C=C3\SC(=S)N(C4CCCC4)C3=O)c(N3CCC(C(N)=O)CC3)nc12 |
| InChI | InChI=1S/C25H28N4O2S2/c1-15-5-4-6-17-13-18(14-20-24(31)29(25(32)33-20)19-7-2-3-8-19)23(27-21(15)17)28-11-9-16(10-12-28)22(26)30/h4-6,13-14,16,19H,2-3,7-12H2,1H3,(H2,26,30)/b20-14- |
| InChIKey | YEWAQASRYKJITN-ZHZULCJRSA-N |
| XLogP | 4.39 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.66 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|