C27H26N4O3S2 — CID 23473822
1-[3-[(Z)-[3-[(4-methoxyphenyl)methyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]quinolin-2-yl]piperidine-4-carboxamide (PubChem CID 23473822) has the molecular formula C27H26N4O3S2 and a molecular weight of 518.66 g/mol. Its IUPAC name is 1-[3-[(Z)-[3-[(4-methoxyphenyl)methyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]quinolin-2-yl]piperidine-4-carboxamide.
| Compound Name | 1-[3-[(Z)-[3-[(4-methoxyphenyl)methyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]quinolin-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 23473822 |
| Molecular Formula | C27H26N4O3S2 |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 518.14 |
| IUPAC Name | 1-[3-[(Z)-[3-[(4-methoxyphenyl)methyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]quinolin-2-yl]piperidine-4-carboxamide |
| SMILES | COc1ccc(CN2C(=O)/C(=C/c3cc4ccccc4nc3N3CCC(C(N)=O)CC3)SC2=S)cc1 |
| InChI | InChI=1S/C27H26N4O3S2/c1-34-21-8-6-17(7-9-21)16-31-26(33)23(36-27(31)35)15-20-14-19-4-2-3-5-22(19)29-25(20)30-12-10-18(11-13-30)24(28)32/h2-9,14-15,18H,10-13,16H2,1H3,(H2,28,32)/b23-15- |
| InChIKey | HQXSDYGFYTULQO-HAHDFKILSA-N |
| XLogP | 4.35 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|