C18H15N5O4 — CID 23474664
N-[2-[(5-methylfuran-2-yl)methyl]pyrazol-3-yl]-2,3-dioxo-1,4-dihydroquinoxaline-6-carboxamide (PubChem CID 23474664) has the molecular formula C18H15N5O4 and a molecular weight of 365.35 g/mol. Its IUPAC name is N-[2-[(5-methylfuran-2-yl)methyl]pyrazol-3-yl]-2,3-dioxo-1,4-dihydroquinoxaline-6-carboxamide.
| Compound Name | N-[2-[(5-methylfuran-2-yl)methyl]pyrazol-3-yl]-2,3-dioxo-1,4-dihydroquinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 23474664 |
| Molecular Formula | C18H15N5O4 |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | N-[2-[(5-methylfuran-2-yl)methyl]pyrazol-3-yl]-2,3-dioxo-1,4-dihydroquinoxaline-6-carboxamide |
| SMILES | Cc1ccc(Cn2nccc2NC(=O)c2ccc3[nH]c(=O)c(=O)[nH]c3c2)o1 |
| InChI | InChI=1S/C18H15N5O4/c1-10-2-4-12(27-10)9-23-15(6-7-19-23)22-16(24)11-3-5-13-14(8-11)21-18(26)17(25)20-13/h2-8H,9H2,1H3,(H,20,25)(H,21,26)(H,22,24) |
| InChIKey | JRSLPJHMHBFOCJ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 125.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|