C14H21ClN3+ — CID 2347500
1-(3-chloro-4-methylphenyl)-2-(1-ethyl-1,2,3,6-tetrahydropyridin-1-ium-4-yl)hydrazine (PubChem CID 2347500) has the molecular formula C14H21ClN3+ and a molecular weight of 266.80 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-2-(1-ethyl-1,2,3,6-tetrahydropyridin-1-ium-4-yl)hydrazine.
| Compound Name | 1-(3-chloro-4-methylphenyl)-2-(1-ethyl-1,2,3,6-tetrahydropyridin-1-ium-4-yl)hydrazine |
|---|---|
| PubChem CID | 2347500 |
| Molecular Formula | C14H21ClN3+ |
| Molecular Weight | 266.80 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-2-(1-ethyl-1,2,3,6-tetrahydropyridin-1-ium-4-yl)hydrazine |
| SMILES | CC[NH+]1CC=C(NNc2ccc(C)c(Cl)c2)CC1 |
| InChI | InChI=1S/C14H20ClN3/c1-3-18-8-6-12(7-9-18)16-17-13-5-4-11(2)14(15)10-13/h4-6,10,16-17H,3,7-9H2,1-2H3/p+1 |
| InChIKey | ODNDEFILLXGZMX-UHFFFAOYSA-O |
| XLogP | 1.76 |
| TPSA | 28.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.80 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|