C14H19N3O2 — CID 2343979
4-[2-(1-ethyl-1,2,3,6-tetrahydropyridin-1-ium-4-yl)hydrazinyl]benzoate (PubChem CID 2343979) has the molecular formula C14H19N3O2 and a molecular weight of 261.33 g/mol. Its IUPAC name is 4-[2-(1-ethyl-1,2,3,6-tetrahydropyridin-1-ium-4-yl)hydrazinyl]benzoate.
| Compound Name | 4-[2-(1-ethyl-1,2,3,6-tetrahydropyridin-1-ium-4-yl)hydrazinyl]benzoate |
|---|---|
| PubChem CID | 2343979 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 4-[2-(1-ethyl-1,2,3,6-tetrahydropyridin-1-ium-4-yl)hydrazinyl]benzoate |
| SMILES | CC[NH+]1CC=C(NNc2ccc(C(=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C14H19N3O2/c1-2-17-9-7-13(8-10-17)16-15-12-5-3-11(4-6-12)14(18)19/h3-7,15-16H,2,8-10H2,1H3,(H,18,19) |
| InChIKey | QZNWBRIDCFQXIQ-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 68.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|