C18H25N2O2- — CID 4308284
4-[2-[4-(2-methylbutan-2-yl)cyclohexen-1-yl]hydrazinyl]benzoate (PubChem CID 4308284) has the molecular formula C18H25N2O2- and a molecular weight of 301.41 g/mol. Its IUPAC name is 4-[2-[4-(2-methylbutan-2-yl)cyclohexen-1-yl]hydrazinyl]benzoate.
| Compound Name | 4-[2-[4-(2-methylbutan-2-yl)cyclohexen-1-yl]hydrazinyl]benzoate |
|---|---|
| PubChem CID | 4308284 |
| Molecular Formula | C18H25N2O2- |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | 4-[2-[4-(2-methylbutan-2-yl)cyclohexen-1-yl]hydrazinyl]benzoate |
| SMILES | CCC(C)(C)C1CC=C(NNc2ccc(C(=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C18H26N2O2/c1-4-18(2,3)14-7-11-16(12-8-14)20-19-15-9-5-13(6-10-15)17(21)22/h5-6,9-11,14,19-20H,4,7-8,12H2,1-3H3,(H,21,22)/p-1 |
| InChIKey | MLEOYBLEXOCKRY-UHFFFAOYSA-M |
| XLogP | 3.09 |
| TPSA | 64.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|