C21H20N2O5 — CID 23475447
2-(3,4-dimethoxyphenyl)-11-hydroxy-7,8,9,11-tetrahydro-6H-pyrido[3,2-c][1]benzazepine-5,10-dione (PubChem CID 23475447) has the molecular formula C21H20N2O5 and a molecular weight of 380.40 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-11-hydroxy-7,8,9,11-tetrahydro-6H-pyrido[3,2-c][1]benzazepine-5,10-dione.
| Compound Name | 2-(3,4-dimethoxyphenyl)-11-hydroxy-7,8,9,11-tetrahydro-6H-pyrido[3,2-c][1]benzazepine-5,10-dione |
|---|---|
| PubChem CID | 23475447 |
| Molecular Formula | C21H20N2O5 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-11-hydroxy-7,8,9,11-tetrahydro-6H-pyrido[3,2-c][1]benzazepine-5,10-dione |
| SMILES | COc1ccc(-c2ccc3c(n2)C(O)C2=C(CCCC2=O)NC3=O)cc1OC |
| InChI | InChI=1S/C21H20N2O5/c1-27-16-9-6-11(10-17(16)28-2)13-8-7-12-19(22-13)20(25)18-14(23-21(12)26)4-3-5-15(18)24/h6-10,20,25H,3-5H2,1-2H3,(H,23,26) |
| InChIKey | FMXAPXHXCFPGSU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |