C23H19ClN6O3 — CID 23484467
4-chloro-N'-[6-[ethyl(naphthalen-1-yl)amino]-5-nitropyrimidin-4-yl]benzohydrazide (PubChem CID 23484467) has the molecular formula C23H19ClN6O3 and a molecular weight of 462.90 g/mol. Its IUPAC name is 4-chloro-N'-[6-[ethyl(naphthalen-1-yl)amino]-5-nitropyrimidin-4-yl]benzohydrazide.
| Compound Name | 4-chloro-N'-[6-[ethyl(naphthalen-1-yl)amino]-5-nitropyrimidin-4-yl]benzohydrazide |
|---|---|
| PubChem CID | 23484467 |
| Molecular Formula | C23H19ClN6O3 |
| Molecular Weight | 462.90 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | 4-chloro-N'-[6-[ethyl(naphthalen-1-yl)amino]-5-nitropyrimidin-4-yl]benzohydrazide |
| SMILES | CCN(c1ncnc(NNC(=O)c2ccc(Cl)cc2)c1[N+](=O)[O-])c1cccc2ccccc12 |
| InChI | InChI=1S/C23H19ClN6O3/c1-2-29(19-9-5-7-15-6-3-4-8-18(15)19)22-20(30(32)33)21(25-14-26-22)27-28-23(31)16-10-12-17(24)13-11-16/h3-14H,2H2,1H3,(H,28,31)(H,25,26,27) |
| InChIKey | BJLPYYXHWNYUMC-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.90 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|