C24H18FN3O4S2 — CID 2348668
N-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-3-[(2-fluorophenyl)sulfamoyl]benzamide (PubChem CID 2348668) has the molecular formula C24H18FN3O4S2 and a molecular weight of 495.56 g/mol. Its IUPAC name is N-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-3-[(2-fluorophenyl)sulfamoyl]benzamide.
| Compound Name | N-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-3-[(2-fluorophenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 2348668 |
| Molecular Formula | C24H18FN3O4S2 |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.07 |
| IUPAC Name | N-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-3-[(2-fluorophenyl)sulfamoyl]benzamide |
| SMILES | CC(=O)c1sc(NC(=O)c2cccc(S(=O)(=O)Nc3ccccc3F)c2)nc1-c1ccccc1 |
| InChI | InChI=1S/C24H18FN3O4S2/c1-15(29)22-21(16-8-3-2-4-9-16)26-24(33-22)27-23(30)17-10-7-11-18(14-17)34(31,32)28-20-13-6-5-12-19(20)25/h2-14,28H,1H3,(H,26,27,30) |
| InChIKey | GNQLWCFUQJLFEU-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |