C19H15ClF3N5O2 — CID 23490010
4-N-[4-chloro-3-(trifluoromethyl)phenyl]-5-nitro-6-N-(2-phenylethyl)pyrimidine-4,6-diamine (PubChem CID 23490010) has the molecular formula C19H15ClF3N5O2 and a molecular weight of 437.81 g/mol. Its IUPAC name is 4-N-[4-chloro-3-(trifluoromethyl)phenyl]-5-nitro-6-N-(2-phenylethyl)pyrimidine-4,6-diamine.
| Compound Name | 4-N-[4-chloro-3-(trifluoromethyl)phenyl]-5-nitro-6-N-(2-phenylethyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23490010 |
| Molecular Formula | C19H15ClF3N5O2 |
| Molecular Weight | 437.81 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | 4-N-[4-chloro-3-(trifluoromethyl)phenyl]-5-nitro-6-N-(2-phenylethyl)pyrimidine-4,6-diamine |
| SMILES | O=[N+]([O-])c1c(NCCc2ccccc2)ncnc1Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H15ClF3N5O2/c20-15-7-6-13(10-14(15)19(21,22)23)27-18-16(28(29)30)17(25-11-26-18)24-9-8-12-4-2-1-3-5-12/h1-7,10-11H,8-9H2,(H2,24,25,26,27) |
| InChIKey | XSUDPLKEGIQWDE-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 92.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.81 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|