C21H22ClN3O3 — CID 2349289
2-[(2-chloroimidazo[1,2-a]pyridine-3-carbonyl)amino]ethyl 4-tert-butylbenzoate (PubChem CID 2349289) has the molecular formula C21H22ClN3O3 and a molecular weight of 399.88 g/mol. Its IUPAC name is 2-[(2-chloroimidazo[1,2-a]pyridine-3-carbonyl)amino]ethyl 4-tert-butylbenzoate.
| Compound Name | 2-[(2-chloroimidazo[1,2-a]pyridine-3-carbonyl)amino]ethyl 4-tert-butylbenzoate |
|---|---|
| PubChem CID | 2349289 |
| Molecular Formula | C21H22ClN3O3 |
| Molecular Weight | 399.88 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 2-[(2-chloroimidazo[1,2-a]pyridine-3-carbonyl)amino]ethyl 4-tert-butylbenzoate |
| SMILES | CC(C)(C)c1ccc(C(=O)OCCNC(=O)c2c(Cl)nc3ccccn23)cc1 |
| InChI | InChI=1S/C21H22ClN3O3/c1-21(2,3)15-9-7-14(8-10-15)20(27)28-13-11-23-19(26)17-18(22)24-16-6-4-5-12-25(16)17/h4-10,12H,11,13H2,1-3H3,(H,23,26) |
| InChIKey | ZWGJNERVOHMPPI-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.88 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|