C18H26N6O2 — CID 23492946
N,N-bis(2-methylpropyl)-5-nitro-6-(2-phenylhydrazinyl)pyrimidin-4-amine (PubChem CID 23492946) has the molecular formula C18H26N6O2 and a molecular weight of 358.45 g/mol. Its IUPAC name is N,N-bis(2-methylpropyl)-5-nitro-6-(2-phenylhydrazinyl)pyrimidin-4-amine.
| Compound Name | N,N-bis(2-methylpropyl)-5-nitro-6-(2-phenylhydrazinyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 23492946 |
| Molecular Formula | C18H26N6O2 |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | N,N-bis(2-methylpropyl)-5-nitro-6-(2-phenylhydrazinyl)pyrimidin-4-amine |
| SMILES | CC(C)CN(CC(C)C)c1ncnc(NNc2ccccc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H26N6O2/c1-13(2)10-23(11-14(3)4)18-16(24(25)26)17(19-12-20-18)22-21-15-8-6-5-7-9-15/h5-9,12-14,21H,10-11H2,1-4H3,(H,19,20,22) |
| InChIKey | FJVPLRMHEAXNTQ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|