C28H27Br2NO — CID 23497956
2,5-bis(4-bromophenyl)-1-(4-hexoxyphenyl)pyrrole (PubChem CID 23497956) has the molecular formula C28H27Br2NO and a molecular weight of 553.34 g/mol. Its IUPAC name is 2,5-bis(4-bromophenyl)-1-(4-hexoxyphenyl)pyrrole.
| Compound Name | 2,5-bis(4-bromophenyl)-1-(4-hexoxyphenyl)pyrrole |
|---|---|
| PubChem CID | 23497956 |
| Molecular Formula | C28H27Br2NO |
| Molecular Weight | 553.34 g/mol |
| Exact Mass | 551.05 |
| IUPAC Name | 2,5-bis(4-bromophenyl)-1-(4-hexoxyphenyl)pyrrole |
| SMILES | CCCCCCOc1ccc(-n2c(-c3ccc(Br)cc3)ccc2-c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C28H27Br2NO/c1-2-3-4-5-20-32-26-16-14-25(15-17-26)31-27(21-6-10-23(29)11-7-21)18-19-28(31)22-8-12-24(30)13-9-22/h6-19H,2-5,20H2,1H3 |
| InChIKey | WRGJXLPQSKVBBC-UHFFFAOYSA-N |
| XLogP | 9.30 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.34 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|