C22H29N5O3 — CID 23499002
5-[7-[(3-methoxyphenyl)methylamino]-1-methyl-3-propylpyrazolo[4,5-d]pyrimidin-5-yl]pentanoic acid (PubChem CID 23499002) has the molecular formula C22H29N5O3 and a molecular weight of 411.51 g/mol. Its IUPAC name is 5-[7-[(3-methoxyphenyl)methylamino]-1-methyl-3-propylpyrazolo[4,5-d]pyrimidin-5-yl]pentanoic acid.
| Compound Name | 5-[7-[(3-methoxyphenyl)methylamino]-1-methyl-3-propylpyrazolo[4,5-d]pyrimidin-5-yl]pentanoic acid |
|---|---|
| PubChem CID | 23499002 |
| Molecular Formula | C22H29N5O3 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | 5-[7-[(3-methoxyphenyl)methylamino]-1-methyl-3-propylpyrazolo[4,5-d]pyrimidin-5-yl]pentanoic acid |
| SMILES | CCCc1nn(C)c2c(NCc3cccc(OC)c3)nc(CCCCC(=O)O)nc12 |
| InChI | InChI=1S/C22H29N5O3/c1-4-8-17-20-21(27(2)26-17)22(23-14-15-9-7-10-16(13-15)30-3)25-18(24-20)11-5-6-12-19(28)29/h7,9-10,13H,4-6,8,11-12,14H2,1-3H3,(H,28,29)(H,23,24,25) |
| InChIKey | UJQOVFQJAUEWFL-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|