C23H30ClN5O3 — CID 23499018
methyl 5-[7-[(3-chloro-4-methoxyphenyl)methylamino]-1-methyl-3-propylpyrazolo[4,5-d]pyrimidin-5-yl]pentanoate (PubChem CID 23499018) has the molecular formula C23H30ClN5O3 and a molecular weight of 459.98 g/mol. Its IUPAC name is methyl 5-[7-[(3-chloro-4-methoxyphenyl)methylamino]-1-methyl-3-propylpyrazolo[4,5-d]pyrimidin-5-yl]pentanoate.
| Compound Name | methyl 5-[7-[(3-chloro-4-methoxyphenyl)methylamino]-1-methyl-3-propylpyrazolo[4,5-d]pyrimidin-5-yl]pentanoate |
|---|---|
| PubChem CID | 23499018 |
| Molecular Formula | C23H30ClN5O3 |
| Molecular Weight | 459.98 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | methyl 5-[7-[(3-chloro-4-methoxyphenyl)methylamino]-1-methyl-3-propylpyrazolo[4,5-d]pyrimidin-5-yl]pentanoate |
| SMILES | CCCc1nn(C)c2c(NCc3ccc(OC)c(Cl)c3)nc(CCCCC(=O)OC)nc12 |
| InChI | InChI=1S/C23H30ClN5O3/c1-5-8-17-21-22(29(2)28-17)23(25-14-15-11-12-18(31-3)16(24)13-15)27-19(26-21)9-6-7-10-20(30)32-4/h11-13H,5-10,14H2,1-4H3,(H,25,26,27) |
| InChIKey | JMIFCQFTLYNXAG-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.98 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|