C32H42 — CID 23499732
1,4-bis[3-methyl-1-(4-methylphenyl)pentyl]benzene (PubChem CID 23499732) has the molecular formula C32H42 and a molecular weight of 426.69 g/mol. Its IUPAC name is 1,4-bis[3-methyl-1-(4-methylphenyl)pentyl]benzene.
| Compound Name | 1,4-bis[3-methyl-1-(4-methylphenyl)pentyl]benzene |
|---|---|
| PubChem CID | 23499732 |
| Molecular Formula | C32H42 |
| Molecular Weight | 426.69 g/mol |
| Exact Mass | 426.33 |
| IUPAC Name | 1,4-bis[3-methyl-1-(4-methylphenyl)pentyl]benzene |
| SMILES | CCC(C)CC(c1ccc(C)cc1)c1ccc(C(CC(C)CC)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C32H42/c1-7-23(3)21-31(27-13-9-25(5)10-14-27)29-17-19-30(20-18-29)32(22-24(4)8-2)28-15-11-26(6)12-16-28/h9-20,23-24,31-32H,7-8,21-22H2,1-6H3 |
| InChIKey | IPIJLMVMLVTZHF-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.69 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |