C12H17BrN4S — CID 23500897
1-(5-bromo-2-pyridinyl)-3-(1-pyrrolidin-1-ylethyl)thiourea (PubChem CID 23500897) has the molecular formula C12H17BrN4S and a molecular weight of 329.27 g/mol. Its IUPAC name is 1-(5-bromo-2-pyridinyl)-3-(1-pyrrolidin-1-ylethyl)thiourea.
| Compound Name | 1-(5-bromo-2-pyridinyl)-3-(1-pyrrolidin-1-ylethyl)thiourea |
|---|---|
| PubChem CID | 23500897 |
| Molecular Formula | C12H17BrN4S |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 1-(5-bromo-2-pyridinyl)-3-(1-pyrrolidin-1-ylethyl)thiourea |
| SMILES | CC(NC(=S)Nc1ccc(Br)cn1)N1CCCC1 |
| InChI | InChI=1S/C12H17BrN4S/c1-9(17-6-2-3-7-17)15-12(18)16-11-5-4-10(13)8-14-11/h4-5,8-9H,2-3,6-7H2,1H3,(H2,14,15,16,18) |
| InChIKey | WEWAWMWSDQMDSD-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|