C15H22BrN3S — CID 3008848
1-(5-bromo-2-pyridinyl)-3-[(2S)-2-cyclohexylpropyl]thiourea (PubChem CID 3008848) has the molecular formula C15H22BrN3S and a molecular weight of 356.33 g/mol. Its IUPAC name is 1-(5-bromo-2-pyridinyl)-3-[(2S)-2-cyclohexylpropyl]thiourea.
| Compound Name | 1-(5-bromo-2-pyridinyl)-3-[(2S)-2-cyclohexylpropyl]thiourea |
|---|---|
| PubChem CID | 3008848 |
| Molecular Formula | C15H22BrN3S |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | 1-(5-bromo-2-pyridinyl)-3-[(2S)-2-cyclohexylpropyl]thiourea |
| SMILES | C[C@H](CNC(=S)Nc1ccc(Br)cn1)C1CCCCC1 |
| InChI | InChI=1S/C15H22BrN3S/c1-11(12-5-3-2-4-6-12)9-18-15(20)19-14-8-7-13(16)10-17-14/h7-8,10-12H,2-6,9H2,1H3,(H2,17,18,19,20)/t11-/m1/s1 |
| InChIKey | FZRVFFSZGBFDBT-LLVKDONJSA-N |
| XLogP | 4.35 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|