C18H17FN2O5S — CID 23501291
2-[1-(2-fluorophenyl)sulfonylindol-4-yl]oxyethyl-methylcarbamic acid (PubChem CID 23501291) has the molecular formula C18H17FN2O5S and a molecular weight of 392.41 g/mol. Its IUPAC name is 2-[1-(2-fluorophenyl)sulfonylindol-4-yl]oxyethyl-methylcarbamic acid.
| Compound Name | 2-[1-(2-fluorophenyl)sulfonylindol-4-yl]oxyethyl-methylcarbamic acid |
|---|---|
| PubChem CID | 23501291 |
| Molecular Formula | C18H17FN2O5S |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 2-[1-(2-fluorophenyl)sulfonylindol-4-yl]oxyethyl-methylcarbamic acid |
| SMILES | CN(CCOc1cccc2c1ccn2S(=O)(=O)c1ccccc1F)C(=O)O |
| InChI | InChI=1S/C18H17FN2O5S/c1-20(18(22)23)11-12-26-16-7-4-6-15-13(16)9-10-21(15)27(24,25)17-8-3-2-5-14(17)19/h2-10H,11-12H2,1H3,(H,22,23) |
| InChIKey | VSQCJNFWQFBLKB-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |