C18H17FN4O3S — CID 23502555
(3-oxocyclohexen-1-yl) 2-[(1-cyclopropyltetrazol-5-yl)sulfanylmethyl]-4-fluorobenzoate (PubChem CID 23502555) has the molecular formula C18H17FN4O3S and a molecular weight of 388.42 g/mol. Its IUPAC name is (3-oxocyclohexen-1-yl) 2-[(1-cyclopropyltetrazol-5-yl)sulfanylmethyl]-4-fluorobenzoate.
| Compound Name | (3-oxocyclohexen-1-yl) 2-[(1-cyclopropyltetrazol-5-yl)sulfanylmethyl]-4-fluorobenzoate |
|---|---|
| PubChem CID | 23502555 |
| Molecular Formula | C18H17FN4O3S |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | (3-oxocyclohexen-1-yl) 2-[(1-cyclopropyltetrazol-5-yl)sulfanylmethyl]-4-fluorobenzoate |
| SMILES | O=C1C=C(OC(=O)c2ccc(F)cc2CSc2nnnn2C2CC2)CCC1 |
| InChI | InChI=1S/C18H17FN4O3S/c19-12-4-7-16(17(25)26-15-3-1-2-14(24)9-15)11(8-12)10-27-18-20-21-22-23(18)13-5-6-13/h4,7-9,13H,1-3,5-6,10H2 |
| InChIKey | XZCMXOKBIJOVFS-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 86.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |