C33H43N7O5 — CID 23504568
N-[1-[[2-[[1-amino-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-2-oxoethyl]amino]-3-methyl-1-oxopentan-2-yl]-1-(2-amino-3-phenylpropanoyl)pyrrolidine-2-carboxamide (PubChem CID 23504568) has the molecular formula C33H43N7O5 and a molecular weight of 617.75 g/mol. Its IUPAC name is N-[1-[[2-[[1-amino-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-2-oxoethyl]amino]-3-methyl-1-oxopentan-2-yl]-1-(2-amino-3-phenylpropanoyl)pyrrolidine-2-carboxamide.
| Compound Name | N-[1-[[2-[[1-amino-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-2-oxoethyl]amino]-3-methyl-1-oxopentan-2-yl]-1-(2-amino-3-phenylpropanoyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 23504568 |
| Molecular Formula | C33H43N7O5 |
| Molecular Weight | 617.75 g/mol |
| Exact Mass | 617.33 |
| IUPAC Name | N-[1-[[2-[[1-amino-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-2-oxoethyl]amino]-3-methyl-1-oxopentan-2-yl]-1-(2-amino-3-phenylpropanoyl)pyrrolidine-2-carboxamide |
| SMILES | CCC(C)C(NC(=O)C1CCCN1C(=O)C(N)Cc1ccccc1)C(=O)NCC(=O)NC(Cc1c[nH]c2ccccc12)C(N)=O |
| InChI | InChI=1S/C33H43N7O5/c1-3-20(2)29(39-31(43)27-14-9-15-40(27)33(45)24(34)16-21-10-5-4-6-11-21)32(44)37-19-28(41)38-26(30(35)42)17-22-18-36-25-13-8-7-12-23(22)25/h4-8,10-13,18,20,24,26-27,29,36H,3,9,14-17,19,34H2,1-2H3,(H2,35,42)(H,37,44)(H,38,41)(H,39,43) |
| InChIKey | NKKQRCBSAQEBSY-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 192.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.75 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |