C20H24FN3 — CID 23504798
3-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-2,3-dihydro-1H-inden-5-amine (PubChem CID 23504798) has the molecular formula C20H24FN3 and a molecular weight of 325.43 g/mol. Its IUPAC name is 3-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-2,3-dihydro-1H-inden-5-amine.
| Compound Name | 3-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-2,3-dihydro-1H-inden-5-amine |
|---|---|
| PubChem CID | 23504798 |
| Molecular Formula | C20H24FN3 |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 3-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-2,3-dihydro-1H-inden-5-amine |
| SMILES | Nc1ccc2c(c1)C(CN1CCN(c3ccc(F)cc3)CC1)CC2 |
| InChI | InChI=1S/C20H24FN3/c21-17-4-7-19(8-5-17)24-11-9-23(10-12-24)14-16-2-1-15-3-6-18(22)13-20(15)16/h3-8,13,16H,1-2,9-12,14,22H2 |
| InChIKey | RABKOSSSNKOOOK-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|