About 1-(3,4-dihydro-1H-isochromen-1-ylmethyl)-4-(4-fluorophenyl)piperazine;dihydrochloride
1-(3,4-dihydro-1H-isochromen-1-ylmethyl)-4-(4-fluorophenyl)piperazine;dihydrochloride (PubChem CID 23288788) has the molecular formula C20H25Cl2FN2O
and a molecular weight of 399.34 g/mol. Its IUPAC name is 1-(3,4-dihydro-1H-isochromen-1-ylmethyl)-4-(4-fluorophenyl)piperazine;dihydrochloride.
Molecular Properties
| Compound Name | 1-(3,4-dihydro-1H-isochromen-1-ylmethyl)-4-(4-fluorophenyl)piperazine;dihydrochloride |
| PubChem CID | 23288788 |
| Molecular Formula | C20H25Cl2FN2O |
| Molecular Weight | 399.34 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 1-(3,4-dihydro-1H-isochromen-1-ylmethyl)-4-(4-fluorophenyl)piperazine;dihydrochloride |
| SMILES | Cl.Cl.Fc1ccc(N2CCN(CC3OCCc4ccccc43)CC2)cc1 |
| InChI | InChI=1S/C20H23FN2O.2ClH/c21-17-5-7-18(8-6-17)23-12-10-22(11-13-23)15-20-19-4-2-1-3-16(19)9-14-24-20;;/h1-8,20H,9-15H2;2*1H |
| InChIKey | DGNPJSZYTYJZNU-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.34 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3,4-dihydro-1H-isochromen-1-ylmethyl)-4-(4-fluorophenyl)piperazine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dihydro-1H-isochromen-1-ylmethyl)-4-(4-fluorophenyl)piperazine;dihydrochloride?
The IUPAC name of 1-(3,4-dihydro-1H-isochromen-1-ylmethyl)-4-(4-fluorophenyl)piperazine;dihydrochloride (CID 23288788) is 1-(3,4-dihydro-1H-isochromen-1-ylmethyl)-4-(4-fluorophenyl)piperazine;dihydrochloride.
What is the SMILES notation for 1-(3,4-dihydro-1H-isochromen-1-ylmethyl)-4-(4-fluorophenyl)piperazine;dihydrochloride?
The canonical SMILES for 1-(3,4-dihydro-1H-isochromen-1-ylmethyl)-4-(4-fluorophenyl)piperazine;dihydrochloride is Cl.Cl.Fc1ccc(N2CCN(CC3OCCc4ccccc43)CC2)cc1.
What is the InChIKey of 1-(3,4-dihydro-1H-isochromen-1-ylmethyl)-4-(4-fluorophenyl)piperazine;dihydrochloride?
The InChIKey is DGNPJSZYTYJZNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23FN2O.2ClH/c21-17-5-7-18(8-6-17)23-12-10-22(11-13-23)15-20-19-4-2-1-3-16(19)9-14-24-20;;/h1-8,20H,9-15H2;2*1H.
What are the key properties of 1-(3,4-dihydro-1H-isochromen-1-ylmethyl)-4-(4-fluorophenyl)piperazine;dihydrochloride?
1-(3,4-dihydro-1H-isochromen-1-ylmethyl)-4-(4-fluorophenyl)piperazine;dihydrochloride has a molecular weight of 399.34 g/mol, XLogP of 4.11, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dihydro-1H-isochromen-1-ylmethyl)-4-(4-fluorophenyl)piperazine;dihydrochloride is sourced from PubChem (CID 23288788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).