C22H28Cl2N2O3 — CID 70082396
1-(1,3-benzodioxol-5-yl)-4-[2-(3,4-dihydro-1H-isochromen-1-yl)ethyl]piperazine;dihydrochloride (PubChem CID 70082396) has the molecular formula C22H28Cl2N2O3 and a molecular weight of 439.38 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-4-[2-(3,4-dihydro-1H-isochromen-1-yl)ethyl]piperazine;dihydrochloride.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-4-[2-(3,4-dihydro-1H-isochromen-1-yl)ethyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 70082396 |
| Molecular Formula | C22H28Cl2N2O3 |
| Molecular Weight | 439.38 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-4-[2-(3,4-dihydro-1H-isochromen-1-yl)ethyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.c1ccc2c(c1)CCOC2CCN1CCN(c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C22H26N2O3.2ClH/c1-2-4-19-17(3-1)8-14-25-20(19)7-9-23-10-12-24(13-11-23)18-5-6-21-22(15-18)27-16-26-21;;/h1-6,15,20H,7-14,16H2;2*1H |
| InChIKey | WHYHQMUJRVDMKH-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|