C22H29Cl2FN2O2 — CID 23288867
1-[2-(6-fluoro-3,4-dihydro-1H-isochromen-1-yl)ethyl]-4-(4-methoxyphenyl)piperazine;dihydrochloride (PubChem CID 23288867) has the molecular formula C22H29Cl2FN2O2 and a molecular weight of 443.39 g/mol. Its IUPAC name is 1-[2-(6-fluoro-3,4-dihydro-1H-isochromen-1-yl)ethyl]-4-(4-methoxyphenyl)piperazine;dihydrochloride.
| Compound Name | 1-[2-(6-fluoro-3,4-dihydro-1H-isochromen-1-yl)ethyl]-4-(4-methoxyphenyl)piperazine;dihydrochloride |
|---|---|
| PubChem CID | 23288867 |
| Molecular Formula | C22H29Cl2FN2O2 |
| Molecular Weight | 443.39 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 1-[2-(6-fluoro-3,4-dihydro-1H-isochromen-1-yl)ethyl]-4-(4-methoxyphenyl)piperazine;dihydrochloride |
| SMILES | COc1ccc(N2CCN(CCC3OCCc4cc(F)ccc43)CC2)cc1.Cl.Cl |
| InChI | InChI=1S/C22H27FN2O2.2ClH/c1-26-20-5-3-19(4-6-20)25-13-11-24(12-14-25)10-8-22-21-7-2-18(23)16-17(21)9-15-27-22;;/h2-7,16,22H,8-15H2,1H3;2*1H |
| InChIKey | PWWOEPCTSVNGHJ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.39 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|