C24H35N5O3 — CID 67633946
(1S)-1-[2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]-3,4-dihydro-1H-isochromen-6-amine;methylurea (PubChem CID 67633946) has the molecular formula C24H35N5O3 and a molecular weight of 441.58 g/mol. Its IUPAC name is (1S)-1-[2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]-3,4-dihydro-1H-isochromen-6-amine;methylurea.
| Compound Name | (1S)-1-[2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]-3,4-dihydro-1H-isochromen-6-amine;methylurea |
|---|---|
| PubChem CID | 67633946 |
| Molecular Formula | C24H35N5O3 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.27 |
| IUPAC Name | (1S)-1-[2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]-3,4-dihydro-1H-isochromen-6-amine;methylurea |
| SMILES | CNC(N)=O.COc1ccc(N2CCN(CC[C@@H]3OCCc4cc(N)ccc43)CC2)cc1 |
| InChI | InChI=1S/C22H29N3O2.C2H6N2O/c1-26-20-5-3-19(4-6-20)25-13-11-24(12-14-25)10-8-22-21-7-2-18(23)16-17(21)9-15-27-22;1-4-2(3)5/h2-7,16,22H,8-15,23H2,1H3;1H3,(H3,3,4,5)/t22-;/m0./s1 |
| InChIKey | CBULIQAKSDQBHB-FTBISJDPSA-N |
| XLogP | 2.39 |
| TPSA | 106.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|