C31H37N3O4 — CID 139807702
2-[1-[2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]-3,4-dihydro-1H-isochromen-6-yl]-N-phenylmethoxyacetamide (PubChem CID 139807702) has the molecular formula C31H37N3O4 and a molecular weight of 515.65 g/mol. Its IUPAC name is 2-[1-[2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]-3,4-dihydro-1H-isochromen-6-yl]-N-phenylmethoxyacetamide.
| Compound Name | 2-[1-[2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]-3,4-dihydro-1H-isochromen-6-yl]-N-phenylmethoxyacetamide |
|---|---|
| PubChem CID | 139807702 |
| Molecular Formula | C31H37N3O4 |
| Molecular Weight | 515.65 g/mol |
| Exact Mass | 515.28 |
| IUPAC Name | 2-[1-[2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]-3,4-dihydro-1H-isochromen-6-yl]-N-phenylmethoxyacetamide |
| SMILES | COc1ccc(N2CCN(CCC3OCCc4cc(CC(=O)NOCc5ccccc5)ccc43)CC2)cc1 |
| InChI | InChI=1S/C31H37N3O4/c1-36-28-10-8-27(9-11-28)34-18-16-33(17-19-34)15-13-30-29-12-7-25(21-26(29)14-20-37-30)22-31(35)32-38-23-24-5-3-2-4-6-24/h2-12,21,30H,13-20,22-23H2,1H3,(H,32,35) |
| InChIKey | WIGISWORCVEGBH-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.65 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|