C26H35N3O3 — CID 139807671
2-[(1S)-1-[2-[4-(4-ethoxyphenyl)piperazin-1-yl]ethyl]-3,4-dihydro-1H-isochromen-6-yl]-N-methylacetamide (PubChem CID 139807671) has the molecular formula C26H35N3O3 and a molecular weight of 437.58 g/mol. Its IUPAC name is 2-[(1S)-1-[2-[4-(4-ethoxyphenyl)piperazin-1-yl]ethyl]-3,4-dihydro-1H-isochromen-6-yl]-N-methylacetamide.
| Compound Name | 2-[(1S)-1-[2-[4-(4-ethoxyphenyl)piperazin-1-yl]ethyl]-3,4-dihydro-1H-isochromen-6-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 139807671 |
| Molecular Formula | C26H35N3O3 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.27 |
| IUPAC Name | 2-[(1S)-1-[2-[4-(4-ethoxyphenyl)piperazin-1-yl]ethyl]-3,4-dihydro-1H-isochromen-6-yl]-N-methylacetamide |
| SMILES | CCOc1ccc(N2CCN(CC[C@@H]3OCCc4cc(CC(=O)NC)ccc43)CC2)cc1 |
| InChI | InChI=1S/C26H35N3O3/c1-3-31-23-7-5-22(6-8-23)29-15-13-28(14-16-29)12-10-25-24-9-4-20(19-26(30)27-2)18-21(24)11-17-32-25/h4-9,18,25H,3,10-17,19H2,1-2H3,(H,27,30)/t25-/m0/s1 |
| InChIKey | LQMPSHHEFOKUEN-VWLOTQADSA-N |
| XLogP | 3.20 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|