(E)-4-ethyl-2-methylundec-2-enoic acid

C14H26O2 — CID 23505055

IUPAC(E)-4-ethyl-2-methylundec-2-enoic acid
SMILESCCCCCCCC(/C=C(\C)C(=O)O)CC
InChIInChI=1S/C14H26O2/c1-4-6-7-8-9-10-13(5-2)11-12(3)14(15)16/h11,13H,4-10H2,1-3H3,(H,15,16)/b12-11+
InChIKeyFFOJTMWEUZRGTQ-VAWYXSNFSA-N
MW226.36 g/mol
LogP4.40
Rot. Bonds9

About (E)-4-ethyl-2-methylundec-2-enoic acid

(E)-4-ethyl-2-methylundec-2-enoic acid (PubChem CID 23505055) has the molecular formula C14H26O2 and a molecular weight of 226.36 g/mol. Its IUPAC name is (E)-4-ethyl-2-methylundec-2-enoic acid.

Molecular Properties

Compound Name(E)-4-ethyl-2-methylundec-2-enoic acid
PubChem CID23505055
Molecular FormulaC14H26O2
Molecular Weight226.36 g/mol
Exact Mass226.19
IUPAC Name(E)-4-ethyl-2-methylundec-2-enoic acid
SMILESCCCCCCCC(/C=C(\C)C(=O)O)CC
InChIInChI=1S/C14H26O2/c1-4-6-7-8-9-10-13(5-2)11-12(3)14(15)16/h11,13H,4-10H2,1-3H3,(H,15,16)/b12-11+
InChIKeyFFOJTMWEUZRGTQ-VAWYXSNFSA-N
XLogP4.40
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds9
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500226.36
LogP ≤ 54.40
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (E)-4-ethyl-2-methylundec-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-4-ethyl-2-methylundec-2-enoic acid?
The IUPAC name of (E)-4-ethyl-2-methylundec-2-enoic acid (CID 23505055) is (E)-4-ethyl-2-methylundec-2-enoic acid.
What is the SMILES notation for (E)-4-ethyl-2-methylundec-2-enoic acid?
The canonical SMILES for (E)-4-ethyl-2-methylundec-2-enoic acid is CCCCCCCC(/C=C(\C)C(=O)O)CC.
What is the InChIKey of (E)-4-ethyl-2-methylundec-2-enoic acid?
The InChIKey is FFOJTMWEUZRGTQ-VAWYXSNFSA-N. The full InChI is InChI=1S/C14H26O2/c1-4-6-7-8-9-10-13(5-2)11-12(3)14(15)16/h11,13H,4-10H2,1-3H3,(H,15,16)/b12-11+.
What are the key properties of (E)-4-ethyl-2-methylundec-2-enoic acid?
(E)-4-ethyl-2-methylundec-2-enoic acid has a molecular weight of 226.36 g/mol, XLogP of 4.40, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-ethyl-2-methylundec-2-enoic acid is sourced from PubChem (CID 23505055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).