C18H26N4 — CID 23506697
1-[2-[6-(2,5-dimethylpyrrol-1-yl)-4-methyl-2-pyridinyl]ethyl]piperazine (PubChem CID 23506697) has the molecular formula C18H26N4 and a molecular weight of 298.43 g/mol. Its IUPAC name is 1-[2-[6-(2,5-dimethylpyrrol-1-yl)-4-methyl-2-pyridinyl]ethyl]piperazine.
| Compound Name | 1-[2-[6-(2,5-dimethylpyrrol-1-yl)-4-methyl-2-pyridinyl]ethyl]piperazine |
|---|---|
| PubChem CID | 23506697 |
| Molecular Formula | C18H26N4 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.22 |
| IUPAC Name | 1-[2-[6-(2,5-dimethylpyrrol-1-yl)-4-methyl-2-pyridinyl]ethyl]piperazine |
| SMILES | Cc1cc(CCN2CCNCC2)nc(-n2c(C)ccc2C)c1 |
| InChI | InChI=1S/C18H26N4/c1-14-12-17(6-9-21-10-7-19-8-11-21)20-18(13-14)22-15(2)4-5-16(22)3/h4-5,12-13,19H,6-11H2,1-3H3 |
| InChIKey | CXUKUKVCPZKXFE-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|