C11H20N4O2S — CID 23506818
N-(2,4-diaminophenyl)-N-[2-(dimethylamino)ethyl]methanesulfonamide (PubChem CID 23506818) has the molecular formula C11H20N4O2S and a molecular weight of 272.37 g/mol. Its IUPAC name is N-(2,4-diaminophenyl)-N-[2-(dimethylamino)ethyl]methanesulfonamide.
| Compound Name | N-(2,4-diaminophenyl)-N-[2-(dimethylamino)ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 23506818 |
| Molecular Formula | C11H20N4O2S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | N-(2,4-diaminophenyl)-N-[2-(dimethylamino)ethyl]methanesulfonamide |
| SMILES | CN(C)CCN(c1ccc(N)cc1N)S(C)(=O)=O |
| InChI | InChI=1S/C11H20N4O2S/c1-14(2)6-7-15(18(3,16)17)11-5-4-9(12)8-10(11)13/h4-5,8H,6-7,12-13H2,1-3H3 |
| InChIKey | OQUJAJUNNIYHAW-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 92.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|