C12H19N3 — CID 18335966
1-N-methyl-1-N-(3-methylbut-2-enyl)benzene-1,2,4-triamine (PubChem CID 18335966) has the molecular formula C12H19N3 and a molecular weight of 205.30 g/mol. Its IUPAC name is 1-N-methyl-1-N-(3-methylbut-2-enyl)benzene-1,2,4-triamine.
| Compound Name | 1-N-methyl-1-N-(3-methylbut-2-enyl)benzene-1,2,4-triamine |
|---|---|
| PubChem CID | 18335966 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 1-N-methyl-1-N-(3-methylbut-2-enyl)benzene-1,2,4-triamine |
| SMILES | CC(C)=CCN(C)c1ccc(N)cc1N |
| InChI | InChI=1S/C12H19N3/c1-9(2)6-7-15(3)12-5-4-10(13)8-11(12)14/h4-6,8H,7,13-14H2,1-3H3 |
| InChIKey | YISBWPPUBDBUOV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|