C19H17N3O3S2 — CID 23508472
[4-[[4-cyano-N-(thiophen-2-ylmethyl)anilino]methyl]phenyl] sulfamate (PubChem CID 23508472) has the molecular formula C19H17N3O3S2 and a molecular weight of 399.50 g/mol. Its IUPAC name is [4-[[4-cyano-N-(thiophen-2-ylmethyl)anilino]methyl]phenyl] sulfamate.
| Compound Name | [4-[[4-cyano-N-(thiophen-2-ylmethyl)anilino]methyl]phenyl] sulfamate |
|---|---|
| PubChem CID | 23508472 |
| Molecular Formula | C19H17N3O3S2 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | [4-[[4-cyano-N-(thiophen-2-ylmethyl)anilino]methyl]phenyl] sulfamate |
| SMILES | N#Cc1ccc(N(Cc2ccc(OS(N)(=O)=O)cc2)Cc2cccs2)cc1 |
| InChI | InChI=1S/C19H17N3O3S2/c20-12-15-3-7-17(8-4-15)22(14-19-2-1-11-26-19)13-16-5-9-18(10-6-16)25-27(21,23)24/h1-11H,13-14H2,(H2,21,23,24) |
| InChIKey | KBORCUHDXYKWRB-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 96.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |