C20H18N2OS2 — CID 31840668
3-(4-cyanophenyl)-N,N-bis(thiophen-2-ylmethyl)propanamide (PubChem CID 31840668) has the molecular formula C20H18N2OS2 and a molecular weight of 366.51 g/mol. Its IUPAC name is 3-(4-cyanophenyl)-N,N-bis(thiophen-2-ylmethyl)propanamide.
| Compound Name | 3-(4-cyanophenyl)-N,N-bis(thiophen-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 31840668 |
| Molecular Formula | C20H18N2OS2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 3-(4-cyanophenyl)-N,N-bis(thiophen-2-ylmethyl)propanamide |
| SMILES | N#Cc1ccc(CCC(=O)N(Cc2cccs2)Cc2cccs2)cc1 |
| InChI | InChI=1S/C20H18N2OS2/c21-13-17-7-5-16(6-8-17)9-10-20(23)22(14-18-3-1-11-24-18)15-19-4-2-12-25-19/h1-8,11-12H,9-10,14-15H2 |
| InChIKey | UEKNJMCHUYNCLQ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |