C15H17N3O7S2 — CID 23508559
[4-[ethyl-(4-sulfamoyloxybenzoyl)amino]phenyl] sulfamate (PubChem CID 23508559) has the molecular formula C15H17N3O7S2 and a molecular weight of 415.45 g/mol. Its IUPAC name is [4-[ethyl-(4-sulfamoyloxybenzoyl)amino]phenyl] sulfamate.
| Compound Name | [4-[ethyl-(4-sulfamoyloxybenzoyl)amino]phenyl] sulfamate |
|---|---|
| PubChem CID | 23508559 |
| Molecular Formula | C15H17N3O7S2 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | [4-[ethyl-(4-sulfamoyloxybenzoyl)amino]phenyl] sulfamate |
| SMILES | CCN(C(=O)c1ccc(OS(N)(=O)=O)cc1)c1ccc(OS(N)(=O)=O)cc1 |
| InChI | InChI=1S/C15H17N3O7S2/c1-2-18(12-5-9-14(10-6-12)25-27(17,22)23)15(19)11-3-7-13(8-4-11)24-26(16,20)21/h3-10H,2H2,1H3,(H2,16,20,21)(H2,17,22,23) |
| InChIKey | CXRGHHALZAWBCO-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 159.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |