C12H18FNO4 — CID 23511737
(2Z)-2-(1-butoxycarbonyl-3-fluoropiperidin-4-ylidene)acetic acid (PubChem CID 23511737) has the molecular formula C12H18FNO4 and a molecular weight of 259.28 g/mol. Its IUPAC name is (2Z)-2-(1-butoxycarbonyl-3-fluoropiperidin-4-ylidene)acetic acid.
| Compound Name | (2Z)-2-(1-butoxycarbonyl-3-fluoropiperidin-4-ylidene)acetic acid |
|---|---|
| PubChem CID | 23511737 |
| Molecular Formula | C12H18FNO4 |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | (2Z)-2-(1-butoxycarbonyl-3-fluoropiperidin-4-ylidene)acetic acid |
| SMILES | CCCCOC(=O)N1CC/C(=C/C(=O)O)C(F)C1 |
| InChI | InChI=1S/C12H18FNO4/c1-2-3-6-18-12(17)14-5-4-9(7-11(15)16)10(13)8-14/h7,10H,2-6,8H2,1H3,(H,15,16)/b9-7- |
| InChIKey | UDERYVOBEZVZQX-CLFYSBASSA-N |
| XLogP | 1.98 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|