C12H20FNO3 — CID 70879988
tert-butyl 3-fluoro-4-(2-hydroxyethylidene)piperidine-1-carboxylate (PubChem CID 70879988) has the molecular formula C12H20FNO3 and a molecular weight of 245.29 g/mol. Its IUPAC name is tert-butyl 3-fluoro-4-(2-hydroxyethylidene)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-fluoro-4-(2-hydroxyethylidene)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 70879988 |
| Molecular Formula | C12H20FNO3 |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | tert-butyl 3-fluoro-4-(2-hydroxyethylidene)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(=CCO)C(F)C1 |
| InChI | InChI=1S/C12H20FNO3/c1-12(2,3)17-11(16)14-6-4-9(5-7-15)10(13)8-14/h5,10,15H,4,6-8H2,1-3H3 |
| InChIKey | GEJKLZOKKCLTNX-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|