C16H19FN4O2 — CID 23512572
2-[2-(dimethylamino)ethylamino]-5-(4-fluoro-2-methylphenyl)pyrimidine-4-carboxylic acid (PubChem CID 23512572) has the molecular formula C16H19FN4O2 and a molecular weight of 318.35 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethylamino]-5-(4-fluoro-2-methylphenyl)pyrimidine-4-carboxylic acid.
| Compound Name | 2-[2-(dimethylamino)ethylamino]-5-(4-fluoro-2-methylphenyl)pyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 23512572 |
| Molecular Formula | C16H19FN4O2 |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 2-[2-(dimethylamino)ethylamino]-5-(4-fluoro-2-methylphenyl)pyrimidine-4-carboxylic acid |
| SMILES | Cc1cc(F)ccc1-c1cnc(NCCN(C)C)nc1C(=O)O |
| InChI | InChI=1S/C16H19FN4O2/c1-10-8-11(17)4-5-12(10)13-9-19-16(18-6-7-21(2)3)20-14(13)15(22)23/h4-5,8-9H,6-7H2,1-3H3,(H,22,23)(H,18,19,20) |
| InChIKey | OEFXGGQZCVXETL-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |