C15H17FN4O3 — CID 22674292
2-[2-(dimethylamino)ethylamino]-4-(4-fluorophenoxy)pyrimidine-5-carboxylic acid (PubChem CID 22674292) has the molecular formula C15H17FN4O3 and a molecular weight of 320.32 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethylamino]-4-(4-fluorophenoxy)pyrimidine-5-carboxylic acid.
| Compound Name | 2-[2-(dimethylamino)ethylamino]-4-(4-fluorophenoxy)pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 22674292 |
| Molecular Formula | C15H17FN4O3 |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 2-[2-(dimethylamino)ethylamino]-4-(4-fluorophenoxy)pyrimidine-5-carboxylic acid |
| SMILES | CN(C)CCNc1ncc(C(=O)O)c(Oc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C15H17FN4O3/c1-20(2)8-7-17-15-18-9-12(14(21)22)13(19-15)23-11-5-3-10(16)4-6-11/h3-6,9H,7-8H2,1-2H3,(H,21,22)(H,17,18,19) |
| InChIKey | XGLDXRXWQFHOGA-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |