C9H7NO6 — CID 23512976
2-hydroxy-7-nitro-2,3-dihydro-1-benzofuran-4-carboxylic acid (PubChem CID 23512976) has the molecular formula C9H7NO6 and a molecular weight of 225.16 g/mol. Its IUPAC name is 2-hydroxy-7-nitro-2,3-dihydro-1-benzofuran-4-carboxylic acid.
| Compound Name | 2-hydroxy-7-nitro-2,3-dihydro-1-benzofuran-4-carboxylic acid |
|---|---|
| PubChem CID | 23512976 |
| Molecular Formula | C9H7NO6 |
| Molecular Weight | 225.16 g/mol |
| Exact Mass | 225.03 |
| IUPAC Name | 2-hydroxy-7-nitro-2,3-dihydro-1-benzofuran-4-carboxylic acid |
| SMILES | O=C(O)c1ccc([N+](=O)[O-])c2c1CC(O)O2 |
| InChI | InChI=1S/C9H7NO6/c11-7-3-5-4(9(12)13)1-2-6(10(14)15)8(5)16-7/h1-2,7,11H,3H2,(H,12,13) |
| InChIKey | QPBXNGDDQVGOFF-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.16 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|