C13H22O5 — CID 23514794
1-O-methyl 6-O-(oxolan-2-yl) 3,4-dimethylhexanedioate (PubChem CID 23514794) has the molecular formula C13H22O5 and a molecular weight of 258.31 g/mol. Its IUPAC name is 1-O-methyl 6-O-(oxolan-2-yl) 3,4-dimethylhexanedioate.
| Compound Name | 1-O-methyl 6-O-(oxolan-2-yl) 3,4-dimethylhexanedioate |
|---|---|
| PubChem CID | 23514794 |
| Molecular Formula | C13H22O5 |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 1-O-methyl 6-O-(oxolan-2-yl) 3,4-dimethylhexanedioate |
| SMILES | COC(=O)CC(C)C(C)CC(=O)OC1CCCO1 |
| InChI | InChI=1S/C13H22O5/c1-9(7-11(14)16-3)10(2)8-12(15)18-13-5-4-6-17-13/h9-10,13H,4-8H2,1-3H3 |
| InChIKey | NWXCHEUQJVBSNC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |